Solabegron

Drugbox
IUPAC_name = 3-(3-(2- [(2-(3-chlorophenyl)-2-hydroxyethyl)amino] ethylamino)phenyl)benzoic acid

---

CAS_number = 451470-34-1
ATC_prefix =
ATC_suffix =
PubChem = 6433123
DrugBank =
C=23|H=23|Cl=1|N=2|O=3
molecular_weight = 410.892 g/mol
smiles = OC(=O)c(c2)cccc2-c1cc(ccc1)NCCNCC(O)c3cccc(Cl)c3
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Solabegron (GW-427,353) is a drug which acts as a selective agonist for the β3 adrenergic receptor. It is being developed for the treatment of overactive bladder and irritable bowel syndrome. [Hicks A, McCafferty GP, Riedel E, Aiyar N, Pullen M, Evans C, Luce TD, Coatney RW, Rivera GC, Westfall TD, Hieble JP. GW427353 (solabegron), a novel, selective beta3-adrenergic receptor agonist, evokes bladder relaxation and increases micturition reflex threshold in the dog. "Journal of Pharmacology and Experimental Therapeutics". 2007 Oct;323(1):202-9. PMID 17626794] [Grudell AB, Camilleri M, Jensen KL, Foxx-Orenstein AE, Burton DD, Ryks MD, Baxter KL, Cox DS, Dukes GE, Kelleher DL, Zinsmeister AR. Dose-response effect of a beta3-adrenergic receptor agonist, solabegron, on gastrointestinal transit, bowel function, and somatostatin levels in health. "American Journal of Physiology. Gastrointestinal and Liver Physiology". 2008 May;294(5):G1114-9. PMID 18372395]

References