Piperidylthiambutene

drugbox
IUPAC_name = 1-(4,4-di(thiophen-2-yl)but-3-en-2-yl)piperidine


width = 180
CAS_number = 54160-31-5
ATC_prefix =
ATC_suffix =
PubChem = 3041503
C=17 | H=21 | N=1 | S=2
molecular_weight = 303.485 g/mol
smiles = C1CCCCN1C(C)C=C(c3cccs3)c2sccc2
melting_point = 188
melting_high = 189
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category =
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

Piperidylthiambutene (Piperidinohton) is an opioid analgesic drug from the thiambutene family, which has around the same potency as morphine. [Adamson DW, Green AF. A new series of analgesics. "Nature". 1950 Jan 21;165(4186):122. PMID 15409854] [Adamson DW, Duffin WM, Green AF. Dithienylbutylamines as analgesics. "Nature". 1951 Jan 27;167(4239):153-4. PMID 14806409] [Green AF. Analgesic and other properties of 3: 3-dithienylalkenylamines. "British Journal of Pharmacology and Chemotherapy". 1953 Mar;8(1):2-9. PMID 13066683] It would be considered an illegal controlled substance analogue in some countries such as the USA, Australia and New Zealand, but is legal in the rest of the world.

References