- SC-17599
drugbox
IUPAC_name = [(8R,9S,10R,13S,14S,17R)-6-(dimethylaminomethyl)-3-ethoxy-17-(2-fluoroacetyl)-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta [a] phenanthren-17-yl] acetate
width = 260
CAS_number =
synonyms = SC-17599, 17α-Acetoxy-6-dimethylaminomethyl-21-fluoro-3-ethoxy-pregna-3,5-dien-20-one
ATC_prefix =
ATC_suffix =
PubChem = 10436424
DrugBank =
C = 28 | H = 42 | F = 1 | N = 1 | O = 4
molecular_weight = 475.634 g/mol
smiles = CC14CCC(OCC)=CC1=C(CN(C)C)CC3C4CCC2(C)C3CCC2(OC(C)=O)C(=O)CF
melting_point =
melting_high =
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Legal
routes_of_administration =SC-17599 is a
steroid derivative drug discovered in 1968 which acts as a selective μ-opioid receptoragonist , with little or no affinity for the δ-opioid or κ-opioid receptors. It is an activeanalgesic "in vivo", more potent thancodeine orpethidine but slightly less potent thanmorphine , [Craig CR. Analgetic Activity and Other Pharmacological Properties of a Steroid; 17α-acetoxy-6-dimethylaminomethyl-21-fluoro-3-ethoxypregna-3,5-dien-20-one Hydrochloride (SC17599) "Journal of Pharmacology And Experimental Therapeutics" 1968; 164(2):371-379.] and produces similar effects to morphine in animals but with lesssedation . [McFadyen IJ, Houshyar H, Liu-Chen LY, Woods JH, Traynor JR. The steroid 17alpha-acetoxy-6-dimethylaminomethyl-21-fluoro-3-ethoxy-pregna-3, 5-dien-20-one (SC17599) is a selective mu-opioid agonist: implications for the mu-opioid pharmacophore. "Molecular Pharmacology". 2000 Oct;58(4):669-76. PMID 10999935] [Houshyar H, Mc Fadyen IJ, Woods JH, Traynor JR. Antinociceptive and other behavioral effects of the steroid SC17599 are mediated by the mu-opioid receptor. "European Journal of Pharmacology". 2000 Apr 28;395(2):121-8. PMID 10794817]References
Wikimedia Foundation. 2010.