Ramatroban

Drugbox
IUPAC_name = 3- [(3"R")-3- [(4-fluorophenyl)sulfonylamino] -1,2,3,4-tetrahydrocarbazol-9-yl] propanoic acid

---

CAS_number = 116649-85-5
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 123879
DrugBank =
chemical_formula =
C=21 | H=21 | F=1 | N=2 | O=4 | S=1
molecular_weight = 416.46 g/mol
smiles = C1CC2=C(CC1NS(=O)(=O)C3=CC=C(C=C3)F)C4=CC=CC=C4N2CCC(=O)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Ramatroban (INN) is a thromboxane receptor antagonist indicated for the treatment of coronary artery disease.cite journal |author=Fiedler VB, Seuter F, Perzborn E |title=Effects of the novel thromboxane antagonist Bay U 3405 on experimental coronary artery disease |journal=Stroke |volume=21 |issue=12 Suppl |pages=IV149–51 |year=1990 |month=December |pmid=2260140 |doi= |url=] It has also been used for the treatment of asthma.cite journal |author=Endo S, Akiyama K |title= [Thromboxane A2 receptor antagonist in asthma therapy] |language=Japanese |journal=Nippon Rinsho |volume=54 |issue=11 |pages=3045–8 |year=1996 |month=November |pmid=8950952 |doi= |url=]

It was developed by the German pharmaceutical company Bayer AG and is co-marketed in Japan by Bayer and Nippon Shinyaku Co. Ltd. under the tradename Baynas.

References

* [http://www.nippon-shinyaku.co.jp/medicine/product/ha/baynas/data/doc_baynas_t.pdf Baynas]