- Razobazam
Drugbox
IUPAC_name = 3,8-dimethyl-4-phenyl-2"H"-pyrazolo [3,4-"b"] [1,4] diazepine-5,7-dione
CAS_number = 78466-98-5
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 71228
DrugBank =
chemical_formula =
C=14 | H=14 | N=4 | O=2
molecular_weight = 270.28 g/mol
smiles = CC1=C2C(=NN1)N(C(=O)CC(=O)N2C3=CC=CC=C3)C
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =Razobazam (INN) is a drug which is a
benzodiazepine derivative. Its mechanism of action appears to be quite different from that of most benzodiazepine drugs, and it producesnootropic effects in animal studies. [Hock FJ, Scheich H. Functional activity in the brain of socially deprivated rats produced by an active avoidance test after razobazam (Hoe 175) treatment: a 2-deoxyglucose study. "Behavioural and Neural Biology". 1986 Nov;46(3):398-409. PMID 3814045]References
Wikimedia Foundation. 2010.