Talipexole

Drugbox
IUPAC_name = 6-allyl-4,5,7,8-tetrahydrothiazolo [5,4-d] azepin-2-amine

---

CAS_number =
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 5374
DrugBank =
chemical_formula =
C=10 | H=15 | N=3 | S=1
molecular_weight = 209.31 g/mol
smiles = C=CCN1CCC2=C(CC1)SC(=N2)N
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Talipexole is a dopamine agonist that has been proposed as an antiparkinsonian agent.cite journal |author=Kitamura Y, Kosaka T, Kakimura JI, "et al" |title=Protective effects of the antiparkinsonian drugs talipexole and pramipexole against 1-methyl-4-phenylpyridinium-induced apoptotic death in human neuroblastoma SH-SY5Y cells |journal=Mol. Pharmacol. |volume=54 |issue=6 |pages=1046–54 |year=1998 |month=December |pmid=9855633 |doi= |url=http://molpharm.aspetjournals.org/cgi/pmidlookup?view=long&pmid=9855633] It also has alpha-adrenergic agonist activity.

References