Itopride

Drugbox
IUPAC_name = "N"- [4-(2-Dimethylaminoethoxy)phenyl] methyl] -3,4-dimethoxybenzamide

---

CAS_number = 122898-67-3
CAS_supplemental =
ATC_prefix =
ATC_suffix =
ATC_supplemental =
PubChem = 3792
DrugBank =
chemical_formula =
C=20 | H=26 | N=2 | O=4
molecular_weight = 358.43 g/mol
smiles = CN(C)CCOC1=CC=C(C=C1)CNC(=O)C2=CC(=C(C=C2)OC)OC
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status = Rx-only
routes_of_administration = Oral

Itopride (INN) is a benzamide derivative which has a gastrokinetic effectcite journal |author=Iwanaga Y, Miyashita N, Saito T, Morikawa K, Itoh Z |title=Gastroprokinetic effect of a new benzamide derivative itopride and its action mechanisms in conscious dogs |journal=Jpn. J. Pharmacol. |volume=71 |issue=2 |pages=129–37 |year=1996 |month=June |pmid=8835639 |doi= |url=http://joi.jlc.jst.go.jp/JST.Journalarchive/jphs1951/71.129?from=PubMed] and is indicated for the treatment of functional dyspepsia.cite journal |author=Holtmann G, Talley NJ, Liebregts T, Adam B, Parow C |title=A placebo-controlled trial of itopride in functional dyspepsia |journal=N. Engl. J. Med. |volume=354 |issue=8 |pages=832–40 |year=2006 |month=February |pmid=16495395 |doi=10.1056/NEJMoa052639 |url=] It has the tradename Ganaton.

References