Glycyrrhizol

Chembox new
Name=Glycyrrhizol A
ImageFile = Glycyrrhizol A.png ImageSize = 200px
IUPACName = 1-Methoxy-2,8-bis-(3-methyl-but-2-enyl)-6"H"-benzo [4,5] furo [3,2-c] chromene-3,9-diol
OtherNames =
Section1 = Chembox Identifiers
CASNo = 877373-00-7
PubChem =
SMILES = C/C(C)=C/CC4=CC1=C(C=C4O)OC3=C1COC2=CC(O)=C(C/C=C(C)/C)C(OC)=C23
Section2 = Chembox Properties
Formula = C₂₆H₂₈O₅
MolarMass = 420.50 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

Glycyrrhizol A is a flavonoid compound isolated from the root of the Chinese Licorice plant ("Glycyrrhiza uralensis").

Recent studies by scientists from UCLA have suggested that these compounds have antibacterial properties. [cite journal | author= He J, Chen L, Shi W, Lu, Q-Y | title=Antibacterial Compounds from "Glycyrrhiza uralensis" | journal=Journal of Natural Products | volume=69| issue=1 | year=2006 | pages=121–124 | id= | doi=10.1021/np058069d] The strongest antibacterial activity was observed against "Streptococcus mutans", an organism known to cause tooth decay in humans.

References