Gemeprost

drugbox
IUPAC_name = methyl ("E")-7- [(1"R",2"S",3"R")-3-hydroxy-2-
[("E",3"R")-3-hydroxy-4,4-dimethyl-oct-1-enyl] -
5-oxo-cyclopentyl] hept-2-enoate

---

CAS_number = 64318-79-2
ATC_prefix = G02
ATC_suffix = AD03
PubChem = 5282237
DrugBank =
C = 23 | H = 38 | O = 5
molecular_weight = 394.545 g/mol
smiles = CCCCC(C)(C)C(C=CC1C(CC(=O)C1CCCCC=CC(=O)OC)O)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration = Pessary

Gemeprost (16, 16-dimethyl-trans-delta2 PGE₁ methyl ester) is an analogue of prostaglandin E₁.

Clinical use

It is used as a treatment for obstetric bleeding.It is used with RU486 to terminate pregnancy up to 24 weeks gestation.

eg. Cervagem

ide effects

Vaginal bleeding, cramps, nausea, vomiting, loose stools or diarrhea, headache, muscle weakness; dizziness; flushing; chills; backache; dyspnoea; chest pain; palpitations and mild pyrexia. Rare: Uterine rupture, severe hypotension, coronary spasms with subsequent myocardial infarctions.