- DOPR
Chembox new
ImageFile1 = DOPR.png
ImageSize1 = 200px
ImageFile2 = DOPR-3d-sticks.png
ImageSize2 = 200px
IUPACName = 2-(2,5-Dimethoxy-4-propyl-phenyl)-1-methyl-ethylamine
OtherNames = 1-(2,5-Dimethoxy-4-propylphenyl)propan-2-amine
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = COc1cc(CCC)c(cc1CC(C)N)OC
Section2 = Chembox Properties
Formula = C13H21NO2
MolarMass = 237.24 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =DOPR, or 2,5-di
methoxy -4-(n)-propyl amphetamine , is a lesser-known psychedelic drug and asubstituted amphetamine . DOPR was first synthesized byAlexander Shulgin . In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the dosage range is listed as 2.5-5 mg, and the duration is listed as 20-30 hours. DOPR is a “heavy dutypsychedelic ,” complete with alterations of the thought-process and visual distortion. Shulgin gives it a +++ on theShulgin Rating Scale . Very little data exists about the pharmacological properties, metabolism, and toxicity of DOPR.See also
*
Phenethylamine
*Psychedelics, dissociatives and deliriants External links
* [http://www.erowid.org/library/books_online/pihkal/pihkal071.shtml DOPR Entry in "PiHKAL"]
Wikimedia Foundation. 2010.