MPM (psychedelic)

Chembox new
ImageFile = MPM.png ImageSize =
IUPACName = 1-(2,4-dimethoxy-5-propoxyphenyl)propan-2-amine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = COc1cc(OC)c(cc1OCCC)CC(C)N
Section2 = Chembox Properties
Formula = C₁₄H₂₃NO₃
MolarMass = 253.337 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MPM, or 2,5-dimethoxy-4-propoxyamphetamine, is a lesser-known psychedelic drug and a substituted amphetamine. MPM was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", neither the dosage nor the duration are known. MPM produces few to no effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of MPM.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal0138.shtml MPM entry in "PiHKAL"]