MME (psychedelic)

Chembox new
ImageFile = MME.png ImageSize =
IUPACName = 1-(5-ethoxy-2,4-dimethoxyphenyl)propan-2-amine
OtherNames =
Section1 = Chembox Identifiers
CASNo =
PubChem =
SMILES = COc1cc(OC)c(cc1OCC)CC(C)N
Section2 = Chembox Properties
Formula = C₁₃H₂₁NO₃
MolarMass = 239.311 g/mol
Appearance =
Density =
MeltingPt =
BoilingPt =
Solubility =
Section3 = Chembox Hazards
MainHazards =
FlashPt =
Autoignition =

MME, or 2,4-dimethoxy-5-ethoxyamphetamine, is a lesser-known psychedelic drug. It is a dimethoxy-ethoxy analog of TMA-2. MME was first synthesized by Alexander Shulgin. In his book "PiHKAL (Phenethylamines i Have Known And Loved)", the minimum dosage is listed as 40mgs, and the duration listed as 6-10 hours. Shulgin gives MME a ++ on the Shulgin Rating Scale. Very little data exists about the pharmacological properties, metabolism, and toxicity of MME.

See also

* Phenethylamine
* Psychedelics, dissociatives and deliriants

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal136.shtml MEM entry in "PiHKAL"]