- 8-OH-DPAT
drugbox
IUPAC_name = 8-Hydroxy-2-(di-n-propylamino)tetralin
width = 200
CAS_number = 78950-78-4
ATC_prefix =
ATC_suffix =
PubChem = 1220
DrugBank =
C=16|H=25|N=1|O=1
molecular_weight = 247.38 g/mol
smiles = CCCN(CCC)C1CCC2=C(C1)C(=CC=C2)O
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category=
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =8-OH-DPAT (8-hydroxy-2-(di-n-propylamino)tertraline) is a substance which acts as an
agonist of the 5HT1A and 5HT7 receptors.cite journal | author = Schuhler S, Saboureau M, Pitrosky B, Pévet P | title = In Syrian hamsters, 5-HT fibres within the suprachiasmatic nuclei are necessary for the expression of 8-OH-DPAT induced phase-advance of locomotor activity rhythm | journal = Neurosci. Lett. | volume = 256 | issue = 1 | pages = 33–6 | year = 1998 | month = October | pmid = 9832210 | doi = 10.1016/S0304-3940(98)00749-6 | url = | issn = ] It can elicit pelvic floor contractions.cite journal | author = Thomas CA, Tyagi S, Yoshimura N, Chancellor MB, Tyagi P | title = Effect of hyperforin-enriched extract on pro-ejaculatory effect of 8-hydroxy-2-(di-N-propylamino)tetralin in anesthetized rats | journal = Urology | volume = 70 | issue = 4 | pages = 813–6 | year = 2007 | month = October | pmid = 17991578 | doi = 10.1016/j.urology.2007.05.016 | url = | issn = ]References
Wikimedia Foundation. 2010.
