MBDB

drugbox
IUPAC_name = 1-(1,3-Benzodioxol-5-yl)-"N"-methylbutan-2-amine

---

---

CAS_number = 103818-46-8
ATC_prefix =
ATC_suffix =
PubChem = 124844
C=12 | H=17 | N=1 | O=2
molecular_weight = 207.27 g/mol
smiles = CCC(CC1=CC2=C(C=C1)OCO2)NC
melting_point = 156
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category =
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

MBDB, or 3,4-methylenedioxy-alpha-ethyl-"N"-methylphenethylamine, is a lesser-known hallucinogenic phenethylamine. It is also known as "EDEN" or "Methyl-J." It is the alpha-ethyl analog of MDMA (Esctasy). It was first synthesized by David E. NicholsFact|date=October 2008, a leading pharmacologist and medicinal chemist, and later tested by Alexander Shulgin and written up in his book, "PiHKAL (Phenethylamines i Have Known And Loved)". MBDB's dosage, according to PiHKAL, is 180-210mg; the proper dosage relative to body mass seems unknown. Its duration is 4-6 hours, with noticeable after-effects lasting for 1-3 hours.

MBDB was initially developed as a non-psychedelic empathogen. It has no effect on the dopamine system which makes it less stimulating and less toxic than MDMA. MBDB causes many mild, MDMA-like effects, such as lowering of social barriers and inhibitions, a pronounced sense of empathy and compassion, and mild happiness, euphoria, and enhanced emotions are all present. However, MBDB's effects are much less profound then those of MDMA. MBDB's effects tend to produce less euphoria, less psychedelia, and have less stimulative properties than MDMA does. Many users declare that MBDB is a "watered-down" version of MDMA as MBDB loses action much more quickly, due to the milder effects, lack of a "rush," and its sedative effects. Despite these features which make MBDB less desirable as a 'recreational' drug, it has been suggested that the drug may have greater therapeutic potential than MDMA because of its decreased toxicity and lengthened duration.

Contraindications

*MAOIs, specifically MAO-A inhibitors and non-selective MAOIs may precipitate serotonin syndrome when combined with MBDB.

*Driving and operating heavy machinery may be especially hazardous as MBDB has a fairly pronounced sedative action.

External links

* [http://www.erowid.org/library/books_online/pihkal/pihkal128.shtml PiHKAL entry]
* [http://www.erowid.org/chemicals/mbdb/mbdb.shtml Erowid MBDB vault]