5-MeO-DALT

drugbox
IUPAC_name = "N"-allyl-"N"- [2-(5-methoxy
-1"H"-indol-3-yl)ethyl]
prop-2-en-1-amine

---

width = 250


width=
CAS_number =
ATC_prefix =
ATC_suffix =
PubChem =
C=17 | H=22 | N=2 | O=1
molecular_weight = 270.375 g/mol
smiles = COc2ccc1ncc(CCN(CC=C)CC=C)c1c2
melting_point =
melting_high =
bioavailability =
protein_bound =
metabolism =
elimination_half-life =
excretion =
pregnancy_AU =
pregnancy_US =
pregnancy_category =
legal_AU =
legal_CA =
legal_UK =
legal_US =
legal_status =
routes_of_administration =

5-MeO-DALT or "N,N"-diallyl-5-methoxytryptamine is a psychedelic tryptamine presumed to be first synthesized by Alexander Shulgin.

Chemistry

The full name of the chemical is "N"-allyl-"N"- [2-(5-methoxy
-1H-indol-3-yl)ethyl] prop-2-en-1-amine. It is very closely related to the compound 5-MeO-DPT and DALT.

Dosage

5-MeO-DALT is usually taken orally at dosages of 12-25mg.

Effects

Some users report 5-MeO-DALT produces rapid, intense entheogenic effects, and it is very short-acting; effects are usually over within 2-4 hours. While other users assert it has absolutely no psychoactive effect. According to many users, the compound is said to be completely void of visual/hallucinogenic activity, unlike other closely related substances.

Dangers

There have been no reported deaths or hospitalizations from 5-MeO-DALT, but its safety profile is unknown.

Legality

5-MeO-DALT is unscheduled and uncontrolled in the United States, but possession and sales of 5-MeO-DALT could be prosecuted under the Federal Analog Act because of its structural similarities to other Schedule I substances.

External links

* [http://www.erowid.org/chemicals/5meo_dalt/5meo_dalt.shtml Erowid 5-MeO-DALT vault]
* [http://www.bluelight.ru/vb/showthread.php?s=&threadid=146249&highlight=5meodalt Bluelight.ru 5-MeO-DALT information]